CAS 20701-77-3 appears in our catalog under these names: Aminopentamide sulfate, 95%, Aminopentamide Sulfate, >95% (HPLC), Aminopentamide sulfate. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 1000mg, 500mg.
4-(dimethylamino)-2,2-diphenylpentanamide;sulfuric acid (CAS 20701-77-3) is a chemical compound with the molecular formula C19H26N2O5S and a molecular weight of 394.5 g/mol. IUPAC name: 4-(dimethylamino)-2,2-diphenylpentanamide;sulfuric acid. InChIKey: GEKOQGPXZRQQHJ-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O5S |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 4-(dimethylamino)-2,2-diphenylpentanamide;sulfuric acid |
| InChIKey | GEKOQGPXZRQQHJ-UHFFFAOYSA-N |
| SMILES | CC(CC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N)N(C)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)