CAS 2070896-27-2 is the registry number for 1-(Benzyloxy)-4-bromo-6-chloro-2-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-bromo-1-chloro-2-phenylmethoxy-3-(trifluoromethyl)benzene (CAS 2070896-27-2) is a chemical compound with the molecular formula C14H9BrClF3O and a molecular weight of 365.57 g/mol. IUPAC name: 5-bromo-1-chloro-2-phenylmethoxy-3-(trifluoromethyl)benzene. InChIKey: QICODKLFTFOHTR-UHFFFAOYSA-N.
| Molecular formula | C14H9BrClF3O |
|---|---|
| Molecular weight | 365.57 g/mol |
| IUPAC name | 5-bromo-1-chloro-2-phenylmethoxy-3-(trifluoromethyl)benzene |
| InChIKey | QICODKLFTFOHTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)