CAS 2071209-49-7 appears in our catalog under these names: CAD031, 98%, CAD031, CAD031 98%, CAD031, 99.39%. Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 50mg, 250mg, 25 mg.
N-(2,4-dimethylphenyl)-2,2,2-trifluoro-N-[(E)-[3-(trifluoromethoxy)phenyl]methylideneamino]acetamide (CAS 2071209-49-7) is a chemical compound with the molecular formula C18H14F6N2O2 and a molecular weight of 404.3 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-2,2,2-trifluoro-N-[(E)-[3-(trifluoromethoxy)phenyl]methylideneamino]acetamide. InChIKey: VDYRRQYRYZTLJV-KIBLKLHPSA-N.
| Molecular formula | C18H14F6N2O2 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-2,2,2-trifluoro-N-[(E)-[3-(trifluoromethoxy)phenyl]methylideneamino]acetamide |
| InChIKey | VDYRRQYRYZTLJV-KIBLKLHPSA-N |
| SMILES | CC1=CC(=C(C=C1)N(C(=O)C(F)(F)F)/N=C/C2=CC(=CC=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)