CAS 207121-39-9 appears in our catalog under these names: Copper(II)tetrafluoroborate hydrate, COPPER(II) TETRAFLUOROBORATE HYDRATE, Copper(II) tetrafluoroborate hydrate, 98%, Copper(II) tetrafluoroborate xhydrate, 98%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 250G, 50G, 100g, 500g.
Copper ditetrafluoroborate (CAS 207121-39-9) is a chemical compound with the molecular formula B2CuF8 and a molecular weight of 237.16 g/mol. IUPAC name: copper ditetrafluoroborate. InChIKey: HMUNZEYTSRPVBE-UHFFFAOYSA-N.
| Molecular formula | B2CuF8 |
|---|---|
| Molecular weight | 237.16 g/mol |
| IUPAC name | copper ditetrafluoroborate |
| InChIKey | HMUNZEYTSRPVBE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Cu+2] |
Computed by PubChem (NCBI)