CAS 207121-42-4 appears in our catalog under these names: Barium 2–cyanoethylphosphate hydrate, Barium 2-Cyanoethylphosphate Hydrate [Phosphorylating Agent], >98.0%(T), 2-Cyanoethyl phosphate barium salt hydrate, 2-Cyanoethyl phosphate barium salt hydra, te, 10 g, 2-Cyanoethyl phosphate barium salt hydra, te, 25 g. Offered by: GLPBio, TCI, Biosynth, Roth. Available pack sizes: 25g, 5g, 10g, 100g.
Barium(2+);2-cyanoethyl phosphate;hydrate (CAS 207121-42-4) is a chemical compound with the molecular formula C3H6BaNO5P and a molecular weight of 304.38 g/mol. IUPAC name: barium(2+);2-cyanoethyl phosphate;hydrate. InChIKey: WRFBUGCJMZIBRQ-UHFFFAOYSA-L.
| Molecular formula | C3H6BaNO5P |
|---|---|
| Molecular weight | 304.38 g/mol |
| IUPAC name | barium(2+);2-cyanoethyl phosphate;hydrate |
| InChIKey | WRFBUGCJMZIBRQ-UHFFFAOYSA-L |
| SMILES | C(COP(=O)([O-])[O-])C#N.O.[Ba+2] |
Computed by PubChem (NCBI)