CAS 207121-48-0 appears in our catalog under these names: L-Cysteinesulfinic Acid, Monohydrate, >95% (HPLC), L-Cysteinesulfinic acid monohydrate/ min. 98%, L–Cysteinesulfinic Acid (hydrate), L-Cysteinesulfinic acid, monohydrate, L-Cysteinesulfinic acid monohydrate 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 10mg, 25mg, 50mg, 0,5g, 0,25g.
(2R)-2-amino-3-sulfinopropanoic acid;hydrate (CAS 207121-48-0) is a chemical compound with the molecular formula C3H9NO5S and a molecular weight of 171.17 g/mol. IUPAC name: (2R)-2-amino-3-sulfinopropanoic acid;hydrate. InChIKey: YQIXTMZYGQXTCZ-DKWTVANSSA-N.
| Molecular formula | C3H9NO5S |
|---|---|
| Molecular weight | 171.17 g/mol |
| IUPAC name | (2R)-2-amino-3-sulfinopropanoic acid;hydrate |
| InChIKey | YQIXTMZYGQXTCZ-DKWTVANSSA-N |
| SMILES | C([C@@H](C(=O)O)N)S(=O)O.O |
Computed by PubChem (NCBI)