CAS 207124-68-3 is the registry number for N,N'-BIS(SALICYLIDENE)ETHYLENEDIAMINO-CO. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
Cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate (CAS 207124-68-3) is a chemical compound with the molecular formula C16H18CoN2O3 and a molecular weight of 345.26 g/mol. IUPAC name: cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate. InChIKey: KMPNPNYOEISGRQ-UHFFFAOYSA-N.
| Molecular formula | C16H18CoN2O3 |
|---|---|
| Molecular weight | 345.26 g/mol |
| IUPAC name | cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate |
| InChIKey | KMPNPNYOEISGRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2O)O.O.[Co] |
Computed by PubChem (NCBI)