CAS 207127-50-2 is the registry number for Cis-decahydro-1-naphthol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (CAS 207127-50-2) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol. InChIKey: NDZOISQLWLWLEW-XMCUXHSSSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| InChIKey | NDZOISQLWLWLEW-XMCUXHSSSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)CCCC2O |
Computed by PubChem (NCBI)