CAS 207127-57-9 appears in our catalog under these names: ((2R,3S,5R)-5-(6-Amino-9h-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate hydrate, 98%, 2'-DEOXYADENOSINE-5'-MONOPHOSPHORIC ACI&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 1G.
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydrate (CAS 207127-57-9) is a chemical compound with the molecular formula C10H16N5O7P and a molecular weight of 349.24 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydrate. InChIKey: QQMAPZSBBNPXKS-VWZUFWLJSA-N.
| Molecular formula | C10H16N5O7P |
|---|---|
| Molecular weight | 349.24 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydrate |
| InChIKey | QQMAPZSBBNPXKS-VWZUFWLJSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)O)O.O |
Computed by PubChem (NCBI)