CAS 20718-46-1 is the registry number for 5-Chloro-4-nitro-2,1,3-benzoselenadiazole. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
5-chloro-4-nitro-2,1,3-benzoselenadiazole (CAS 20718-46-1) is a chemical compound with the molecular formula C6H2ClN3O2Se and a molecular weight of 262.52 g/mol. IUPAC name: 5-chloro-4-nitro-2,1,3-benzoselenadiazole. InChIKey: TZPWJERFLDFTSH-UHFFFAOYSA-N.
| Molecular formula | C6H2ClN3O2Se |
|---|---|
| Molecular weight | 262.52 g/mol |
| IUPAC name | 5-chloro-4-nitro-2,1,3-benzoselenadiazole |
| InChIKey | TZPWJERFLDFTSH-UHFFFAOYSA-N |
| SMILES | C1=CC2=N[Se]N=C2C(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)