CAS 207231-25-2 is the registry number for 4-Chloro-6,7,8-trifluoroquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-6,7,8-trifluoroquinoline-3-carboxylic acid (CAS 207231-25-2) is a chemical compound with the molecular formula C10H3ClF3NO2 and a molecular weight of 261.58 g/mol. IUPAC name: 4-chloro-6,7,8-trifluoroquinoline-3-carboxylic acid. InChIKey: NJZRDDAKYGCCPV-UHFFFAOYSA-N.
| Molecular formula | C10H3ClF3NO2 |
|---|---|
| Molecular weight | 261.58 g/mol |
| IUPAC name | 4-chloro-6,7,8-trifluoroquinoline-3-carboxylic acid |
| InChIKey | NJZRDDAKYGCCPV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1F)F)F)N=CC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)