CAS 207291-72-3 is the registry number for Ethyl 5-hydroxy-3-methyl-4-isoxazolecarboxylate sodium salt hydrate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
Sodium;4-ethoxycarbonyl-3-methyl-1,2-oxazol-5-olate;hydrate (CAS 207291-72-3) is a chemical compound with the molecular formula C7H10NNaO5 and a molecular weight of 211.15 g/mol. IUPAC name: sodium;4-ethoxycarbonyl-3-methyl-1,2-oxazol-5-olate;hydrate. InChIKey: FUQGYGTVHBHPSD-UHFFFAOYSA-M.
| Molecular formula | C7H10NNaO5 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | sodium;4-ethoxycarbonyl-3-methyl-1,2-oxazol-5-olate;hydrate |
| InChIKey | FUQGYGTVHBHPSD-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=C(ON=C1C)[O-].O.[Na+] |
Computed by PubChem (NCBI)