CAS 207300-85-4 appears in our catalog under these names: Guanosine 5'-triphosphate trisodium hydrate, Guanosine 5′-(tetrahydrogen triphosphate), trisodium salt, hydrate, Guanosine 5'-triphosphate (trisodium salt hydrate), 95.0%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 1000mg, 50mg, 250mg, 1 g, 500 mg, 200 mg, 100 mg, 50 mg.
CAS 207300-85-4 identifies a chemical compound with the molecular formula C10H18N5NaO15P3 and a molecular weight of 564.19 g/mol. InChIKey: ZUJHRHWQCABYTF-LGVAUZIVSA-N.
| Molecular formula | C10H18N5NaO15P3 |
|---|---|
| Molecular weight | 564.19 g/mol |
| InChIKey | ZUJHRHWQCABYTF-LGVAUZIVSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N.O.[Na] |
Computed by PubChem (NCBI)