CAS 207399-12-0 appears in our catalog under these names: Iron(III) citrate hydrate, 2-Hydroxypropane-1,2,3-tricarboxylic acid iron(III) salt xhydrate. Offered by: GLPBio, Chemat. Available pack sizes: 500g, 100g, 2.5kg.
2-hydroxypropane-1,2,3-tricarboxylic acid;iron;hydrate (CAS 207399-12-0) is a chemical compound with the molecular formula C6H10FeO8 and a molecular weight of 265.98 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid;iron;hydrate. InChIKey: KTOMARYOAQYGRU-UHFFFAOYSA-N.
| Molecular formula | C6H10FeO8 |
|---|---|
| Molecular weight | 265.98 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;iron;hydrate |
| InChIKey | KTOMARYOAQYGRU-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O.[Fe] |
Computed by PubChem (NCBI)