CAS 207456-83-5 is the registry number for 4-Methyl-3-penten-2-one-d10, 99 atom % D, min 96% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,1,1,3,5,5,5-heptadeuterio-4-(trideuteriomethyl)pent-3-en-2-one (CAS 207456-83-5) is a chemical compound with the molecular formula C6H10O and a molecular weight of 108.20 g/mol. IUPAC name: 1,1,1,3,5,5,5-heptadeuterio-4-(trideuteriomethyl)pent-3-en-2-one. InChIKey: SHOJXDKTYKFBRD-LSURFNHSSA-N.
| Molecular formula | C6H10O |
|---|---|
| Molecular weight | 108.20 g/mol |
| IUPAC name | 1,1,1,3,5,5,5-heptadeuterio-4-(trideuteriomethyl)pent-3-en-2-one |
| InChIKey | SHOJXDKTYKFBRD-LSURFNHSSA-N |
| SMILES | [2H]C(=C(C([2H])([2H])[2H])C([2H])([2H])[2H])C(=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)