Products 2075718-26-0
CAS 2075718-26-0 is the registry number for Propyl paraben-13C6, 99.99%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Propyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 2075718-26-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 186.16 g/mol. IUPAC name: propyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: QELSKZZBTMNZEB-CICUYXHZSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | propyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | QELSKZZBTMNZEB-CICUYXHZSA-N |
| SMILES | CCCOC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)