CAS 2076-91-7 appears in our catalog under these names: Tpt-260 dihydrochloride, 95%, TPT–260 Dihydrochloride, TPT-260 Dihydrochloride, TPT-260 (Dihydrochloride), 98.0%, TPT-260 2HCL, ≥98%. Offered by: Combi-blocks, GLPBio, TargetMol, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 10mM * 1ml in dmso, 2mg, 25mg, 200mg.
[5-(carbamimidoylsulfanylmethyl)thiophen-2-yl]methyl carbamimidothioate;hydrochloride (CAS 2076-91-7) is a chemical compound with the molecular formula C8H13ClN4S3 and a molecular weight of 296.9 g/mol. IUPAC name: [5-(carbamimidoylsulfanylmethyl)thiophen-2-yl]methyl carbamimidothioate;hydrochloride. InChIKey: PYIIEKPQGRXMHN-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4S3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [5-(carbamimidoylsulfanylmethyl)thiophen-2-yl]methyl carbamimidothioate;hydrochloride |
| InChIKey | PYIIEKPQGRXMHN-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)CSC(=N)N)CSC(=N)N.Cl |
Computed by PubChem (NCBI)