CAS 207619-50-9 is the registry number for N,N-Diisopropyl-1h-indole-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-di(propan-2-yl)-1H-indole-3-carboxamide (CAS 207619-50-9) is a chemical compound with the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. IUPAC name: N,N-di(propan-2-yl)-1H-indole-3-carboxamide. InChIKey: KDFREVDAPBWYNY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | N,N-di(propan-2-yl)-1H-indole-3-carboxamide |
| InChIKey | KDFREVDAPBWYNY-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)