CAS 20762-31-6 appears in our catalog under these names: H-Trp-gly-gly-oh, 95%, H-Trp-Gly-Gly-OH, 97%, H–Trp–Gly–Gly–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-[[2-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]acetyl]amino]acetic acid (CAS 20762-31-6) is a chemical compound with the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. IUPAC name: 2-[[2-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]acetyl]amino]acetic acid. InChIKey: GDTKLBWSCOKFCA-NSHDSACASA-N.
| Molecular formula | C15H18N4O4 |
|---|---|
| Molecular weight | 318.33 g/mol |
| IUPAC name | 2-[[2-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]acetyl]amino]acetic acid |
| InChIKey | GDTKLBWSCOKFCA-NSHDSACASA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C[C@@H](C(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)