CAS 20766-99-8 is the registry number for 2,6-Diisopropyl-4-methylphenol, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
4-methyl-2,6-di(propan-2-yl)phenol (CAS 20766-99-8) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: 4-methyl-2,6-di(propan-2-yl)phenol. InChIKey: PNTYWMCFKKJDAA-UHFFFAOYSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | 4-methyl-2,6-di(propan-2-yl)phenol |
| InChIKey | PNTYWMCFKKJDAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)C)O)C(C)C |
Computed by PubChem (NCBI)