Products 207691-65-4

CAS 207691-65-4 is the registry number for 1-Boc-4-(1-pyrrolidinyl)-3,6-dihydro-2h-pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 207691-65-4) is a chemical compound with the molecular formula C14H24N2O2 and a molecular weight of 252.35 g/mol. IUPAC name: tert-butyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: ULPQSKBVAPQQTP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O2
Molecular weight252.35 g/mol
IUPAC nametert-butyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate
InChIKeyULPQSKBVAPQQTP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=CC1)N2CCCC2

Computed by PubChem (NCBI)