CAS 207727-86-4 appears in our catalog under these names: O-(2-Nitrobenzyl)-l-tyrosine hydrochloride, 95%, O-(2-Nitrobenzyl)-L-tyrosine Hydrochloride, NB-caged Tyrosine hydrochloride, NB–caged Tyrosine hydrochloride, (S)-2-Amino-3-(4-((2-nitrobenzyl)oxy)phenyl)propanoic acid hydrochloride, 96%, 96%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 2,5g, 5mg, 100mg.
(2S)-2-amino-3-[4-[(2-nitrophenyl)methoxy]phenyl]propanoic acid;hydrochloride (CAS 207727-86-4) is a chemical compound with the molecular formula C16H17ClN2O5 and a molecular weight of 352.77 g/mol. IUPAC name: (2S)-2-amino-3-[4-[(2-nitrophenyl)methoxy]phenyl]propanoic acid;hydrochloride. InChIKey: DRUCEARMIBXBOJ-UQKRIMTDSA-N.
| Molecular formula | C16H17ClN2O5 |
|---|---|
| Molecular weight | 352.77 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[(2-nitrophenyl)methoxy]phenyl]propanoic acid;hydrochloride |
| InChIKey | DRUCEARMIBXBOJ-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)