CAS 20779-08-2 is the registry number for Zinccaproate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc bis(hexanoate) (CAS 20779-08-2) is a chemical compound with the molecular formula C12H22O4Zn and a molecular weight of 295.7 g/mol. IUPAC name: zinc bis(hexanoate). InChIKey: PKJOUIVGCFHFTK-UHFFFAOYSA-L.
| Molecular formula | C12H22O4Zn |
|---|---|
| Molecular weight | 295.7 g/mol |
| IUPAC name | zinc bis(hexanoate) |
| InChIKey | PKJOUIVGCFHFTK-UHFFFAOYSA-L |
| SMILES | CCCCCC(=O)[O-].CCCCCC(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)