CAS 20779-13-9 appears in our catalog under these names: 1,5-Naphthalenedisulfonic acid dimethyl ester, 98%, Dimethyl naphthalene-1,5-disulfonate, 98%, Dimethyl 1,5–Naphthalenedisulfonate, Dimethyl 1,5-Naphthalenedisulfonate, >98.0%(GC), Dimethyl naphthalene-1,5-disulfonate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
Dimethyl naphthalene-1,5-disulfonate (CAS 20779-13-9) is a chemical compound with the molecular formula C12H12O6S2 and a molecular weight of 316.4 g/mol. IUPAC name: dimethyl naphthalene-1,5-disulfonate. InChIKey: HCXPJMZQMWIBMO-UHFFFAOYSA-N.
| Molecular formula | C12H12O6S2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | dimethyl naphthalene-1,5-disulfonate |
| InChIKey | HCXPJMZQMWIBMO-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=CC2=C1C=CC=C2S(=O)(=O)OC |
Computed by PubChem (NCBI)