Products 2077980-80-2
CAS 2077980-80-2 is the registry number for GLL398. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4-[(Z)-1-(4-boronophenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (CAS 2077980-80-2) is a chemical compound with the molecular formula C25H23BO4 and a molecular weight of 398.3 g/mol. IUPAC name: (E)-3-[4-[(Z)-1-(4-boronophenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid. InChIKey: BINZFDGAOTWQNC-YGCRUXFTSA-N.
| Molecular formula | C25H23BO4 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | (E)-3-[4-[(Z)-1-(4-boronophenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| InChIKey | BINZFDGAOTWQNC-YGCRUXFTSA-N |
| SMILES | B(C1=CC=C(C=C1)/C(=C(\CC)/C2=CC=CC=C2)/C3=CC=C(C=C3)/C=C/C(=O)O)(O)O |
Computed by PubChem (NCBI)