CAS 207861-61-8 appears in our catalog under these names: Bis(trifluoromethane)sulfonimide cobalt, 95%, Cobalt bis(trifluoromethylsulfonyl)imide , Cobalt bis(trifluoromethylsulfonyl)imide 98%, Bis[1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl-κO]methanesulfonamidato-κO]-,cobalt, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 10g, 100g.
Bis(bis(trifluoromethylsulfonyl)azanide);cobalt(2+) (CAS 207861-61-8) is a chemical compound with the molecular formula C4CoF12N2O8S4 and a molecular weight of 619.2 g/mol. IUPAC name: bis(bis(trifluoromethylsulfonyl)azanide);cobalt(2+). InChIKey: HRURXKIZWNSHQB-UHFFFAOYSA-N.
| Molecular formula | C4CoF12N2O8S4 |
|---|---|
| Molecular weight | 619.2 g/mol |
| IUPAC name | bis(bis(trifluoromethylsulfonyl)azanide);cobalt(2+) |
| InChIKey | HRURXKIZWNSHQB-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Co+2] |
Computed by PubChem (NCBI)