CAS 2079069-01-3 appears in our catalog under these names: Casein Kinase inhibitor A86, Casein Kinase inhibitor A86, 98%, 98%, Casein Kinase inhibitor A86, 99.26%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 100 mg, 10 mg, 10mM/1mL, 5 mg.
4-N-[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]cyclohexane-1,4-diamine (CAS 2079069-01-3) is a chemical compound with the molecular formula C18H25FN6 and a molecular weight of 344.4 g/mol. IUPAC name: 4-N-[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]cyclohexane-1,4-diamine. InChIKey: YSPIHUWHLMNFOV-UHFFFAOYSA-N.
| Molecular formula | C18H25FN6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 4-N-[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]cyclohexane-1,4-diamine |
| InChIKey | YSPIHUWHLMNFOV-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=NC(=NC=C2F)NC3CCC(CC3)N)CC4CC4 |
Computed by PubChem (NCBI)