Products 2079885-05-3
CAS 2079885-05-3 appears in our catalog under these names: L-Moses, L-Moses, 99.97%, L-Moses, 99.0%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 10mM/1mL, 5 mg, 10 mg.
(1S,2S)-1-N,1-N-dimethyl-2-N-(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)-1-phenylpropane-1,2-diamine (CAS 2079885-05-3) is a chemical compound with the molecular formula C21H24N6 and a molecular weight of 360.5 g/mol. IUPAC name: (1S,2S)-1-N,1-N-dimethyl-2-N-(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)-1-phenylpropane-1,2-diamine. InChIKey: MSFPLTWUFWOKBX-IFXJQAMLSA-N.
| Molecular formula | C21H24N6 |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | (1S,2S)-1-N,1-N-dimethyl-2-N-(3-methyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)-1-phenylpropane-1,2-diamine |
| InChIKey | MSFPLTWUFWOKBX-IFXJQAMLSA-N |
| SMILES | CC1=NN=C2N1N=C(C3=CC=CC=C32)N[C@@H](C)[C@H](C4=CC=CC=C4)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
L-Moses, orb1709300