CAS 2079896-25-4 appears in our catalog under these names: GSK 4027, GSK 4027, 99%, GSK 4027, GSK4027, 98.80%, 98.80%, GSK 4027, 98.22%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 25mg, 100mg, 1mg, 5mg, 10mg, 10mM (in 1ml dmso), 50mg, 100 mg.
4-bromo-2-methyl-5-[[(3R,5R)-1-methyl-5-phenylpiperidin-3-yl]amino]pyridazin-3-one (CAS 2079896-25-4) is a chemical compound with the molecular formula C17H21BrN4O and a molecular weight of 377.3 g/mol. IUPAC name: 4-bromo-2-methyl-5-[[(3R,5R)-1-methyl-5-phenylpiperidin-3-yl]amino]pyridazin-3-one. InChIKey: VZAFGXCWAWRULT-UONOGXRCSA-N.
| Molecular formula | C17H21BrN4O |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 4-bromo-2-methyl-5-[[(3R,5R)-1-methyl-5-phenylpiperidin-3-yl]amino]pyridazin-3-one |
| InChIKey | VZAFGXCWAWRULT-UONOGXRCSA-N |
| SMILES | CN1C[C@H](C[C@H](C1)NC2=C(C(=O)N(N=C2)C)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)