CAS 2079925-34-9 is the registry number for 4-(tert-Butyl) 1-methyl (S)-2-((R)-1-(4-bromophenyl)ethyl)-2-methylsuccinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-O-tert-butyl 1-O-methyl (2S)-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methylbutanedioate (CAS 2079925-34-9) is a chemical compound with the molecular formula C18H25BrO4 and a molecular weight of 385.3 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2S)-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methylbutanedioate. InChIKey: ARWNAXBRNADXIR-XIKOKIGWSA-N.
| Molecular formula | C18H25BrO4 |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2S)-2-[(1R)-1-(4-bromophenyl)ethyl]-2-methylbutanedioate |
| InChIKey | ARWNAXBRNADXIR-XIKOKIGWSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Br)[C@](C)(CC(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)