CAS 208038-84-0 is the registry number for 3-Nitro-5-(2,2,3,3-tetrafluoropropoxy)-aniline, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
3-nitro-5-(2,2,3,3-tetrafluoropropoxy)aniline (CAS 208038-84-0) is a chemical compound with the molecular formula C9H8F4N2O3 and a molecular weight of 268.16 g/mol. IUPAC name: 3-nitro-5-(2,2,3,3-tetrafluoropropoxy)aniline. InChIKey: BUPGJWMGPAHCGC-UHFFFAOYSA-N.
| Molecular formula | C9H8F4N2O3 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 3-nitro-5-(2,2,3,3-tetrafluoropropoxy)aniline |
| InChIKey | BUPGJWMGPAHCGC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])OCC(C(F)F)(F)F)N |
Computed by PubChem (NCBI)