Products 208182-49-4
CAS 208182-49-4 is the registry number for p38 MAPK-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(4-fluorophenyl)-2-(4-methylphenyl)-1H-imidazol-5-yl]pyridine (CAS 208182-49-4) is a chemical compound with the molecular formula C21H16FN3 and a molecular weight of 329.4 g/mol. IUPAC name: 4-[4-(4-fluorophenyl)-2-(4-methylphenyl)-1H-imidazol-5-yl]pyridine. InChIKey: WBTZEYLGSORECL-UHFFFAOYSA-N.
| Molecular formula | C21H16FN3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-[4-(4-fluorophenyl)-2-(4-methylphenyl)-1H-imidazol-5-yl]pyridine |
| InChIKey | WBTZEYLGSORECL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)