CAS 2082699-27-0 is the registry number for N'-((2-Bromopyridin-3-yl)methylene)-4-methylbenzenesulfonohydrazide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
N-[(E)-(2-bromo-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2082699-27-0) is a chemical compound with the molecular formula C13H12BrN3O2S and a molecular weight of 354.22 g/mol. IUPAC name: N-[(E)-(2-bromo-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: CCUGSLQJJNKAJS-CXUHLZMHSA-N.
| Molecular formula | C13H12BrN3O2S |
|---|---|
| Molecular weight | 354.22 g/mol |
| IUPAC name | N-[(E)-(2-bromo-3-pyridinyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | CCUGSLQJJNKAJS-CXUHLZMHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=C(N=CC=C2)Br |
Computed by PubChem (NCBI)