CAS 2083627-02-3 appears in our catalog under these names: EED226/ 99.66% (existing batch purity), EED226, EED 226 monohydrate, EED226, 95%, MAK683, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1g.
N-(furan-2-ylmethyl)-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine (CAS 2083627-02-3) is a chemical compound with the molecular formula C17H15N5O3S and a molecular weight of 369.4 g/mol. IUPAC name: N-(furan-2-ylmethyl)-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine. InChIKey: DYIRSNMPIZZNBK-UHFFFAOYSA-N.
| Molecular formula | C17H15N5O3S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine |
| InChIKey | DYIRSNMPIZZNBK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CN=C(N3C2=NN=C3)NCC4=CC=CO4 |
Computed by PubChem (NCBI)