CAS 20838-22-6 is the registry number for 2'-Deoxyadenosine 3',5'-Dibenzoate. Offered by: TRC. Available pack sizes: 2,5g.
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate (CAS 20838-22-6) is a chemical compound with the molecular formula C24H21N5O5 and a molecular weight of 459.5 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: BSYKOWLGCUELNQ-IPMKNSEASA-N.
| Molecular formula | C24H21N5O5 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-benzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | BSYKOWLGCUELNQ-IPMKNSEASA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)