CAS 20838-63-5 is the registry number for Phenyl O-Glucuronide Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 20838-63-5 identifies a chemical compound with the molecular formula C12H14NaO7 and a molecular weight of 293.22 g/mol. InChIKey: OBJZMDMNHLJHEL-BLKPXHQLSA-N.
| Molecular formula | C12H14NaO7 |
|---|---|
| Molecular weight | 293.22 g/mol |
| InChIKey | OBJZMDMNHLJHEL-BLKPXHQLSA-N |
| SMILES | C1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O.[Na] |
Computed by PubChem (NCBI)