CAS 208465-21-8 appears in our catalog under these names: Mesosulfuron-methyl, Mesosulfuron-methyl, >95% (HPLC), Mesosulfuron-methyl/ 97.27% (existing batch purity), Mesosulfuron–Methyl, MESOSULFURON-METHYL, PESTANAL. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 1g, 5g, 10mg, 25mg, 50mg, 500mg.
Methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate (CAS 208465-21-8) is a chemical compound with the molecular formula C17H21N5O9S2 and a molecular weight of 503.5 g/mol. IUPAC name: methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate. InChIKey: NIFKBBMCXCMCAO-UHFFFAOYSA-N.
| Molecular formula | C17H21N5O9S2 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate |
| InChIKey | NIFKBBMCXCMCAO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)CNS(=O)(=O)C)C(=O)OC)OC |
Computed by PubChem (NCBI)