CAS 2085843-51-0 is the registry number for Neptinib. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 100 mg, 10 mg, 5 mg.
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 2085843-51-0) is a chemical compound with the molecular formula C22H23ClFN5O2 and a molecular weight of 443.9 g/mol. IUPAC name: (E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: RTAAZCCTCLCXHX-AATRIKPKSA-N.
| Molecular formula | C22H23ClFN5O2 |
|---|---|
| Molecular weight | 443.9 g/mol |
| IUPAC name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | RTAAZCCTCLCXHX-AATRIKPKSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)NC(=O)/C=C/CN(C)C |
Computed by PubChem (NCBI)