CAS 2086312-08-3 is the registry number for 4-Tricyclo[3.3.1.13,7]dec-1-yl[1,1′:3′,1′′-terphenyl]-4′-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(1-adamantyl)phenyl]-2-phenylaniline (CAS 2086312-08-3) is a chemical compound with the molecular formula C28H29N and a molecular weight of 379.5 g/mol. IUPAC name: 4-[4-(1-adamantyl)phenyl]-2-phenylaniline. InChIKey: UZAZWEOBCTYWQI-UHFFFAOYSA-N.
| Molecular formula | C28H29N |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 4-[4-(1-adamantyl)phenyl]-2-phenylaniline |
| InChIKey | UZAZWEOBCTYWQI-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)C5=CC(=C(C=C5)N)C6=CC=CC=C6 |
Computed by PubChem (NCBI)