CAS 2410845-64-4 is the registry number for N-(4-Tricyclo[3.3.1.13,7]dec-1-ylphenyl)[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[4-(1-adamantyl)phenyl]-4-phenylaniline (CAS 2410845-64-4) is a chemical compound with the molecular formula C28H29N and a molecular weight of 379.5 g/mol. IUPAC name: N-[4-(1-adamantyl)phenyl]-4-phenylaniline. InChIKey: PMLDETAHTIJGAC-UHFFFAOYSA-N.
| Molecular formula | C28H29N |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | N-[4-(1-adamantyl)phenyl]-4-phenylaniline |
| InChIKey | PMLDETAHTIJGAC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)NC5=CC=C(C=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)