CAS 208651-58-5 is the registry number for 4-Nitrophenyl phosphate potassium salt. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
Potassium (4-nitrophenyl) hydrogen phosphate (CAS 208651-58-5) is a chemical compound with the molecular formula C6H5KNO6P and a molecular weight of 257.18 g/mol. IUPAC name: potassium (4-nitrophenyl) hydrogen phosphate. InChIKey: FYMPXUMYQRBYBB-UHFFFAOYSA-M.
| Molecular formula | C6H5KNO6P |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | potassium (4-nitrophenyl) hydrogen phosphate |
| InChIKey | FYMPXUMYQRBYBB-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)[O-].[K+] |
Computed by PubChem (NCBI)