CAS 20866-48-2 appears in our catalog under these names: Boc–Tyr(Boc)–OH, Boc-L-Tyr(Boc)-OH, Boc-Tyr(Boc)-OH, 97%, 97%, Boc-Tyr(Boc)-OH, 99.92%, Boc-Tyr(Boc)-OH, 95%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 10 g, 5 g, 25 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoic acid (CAS 20866-48-2) is a chemical compound with the molecular formula C19H27NO7 and a molecular weight of 381.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoic acid. InChIKey: MRYIHKCPPKHOPJ-AWEZNQCLSA-N.
| Molecular formula | C19H27NO7 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propanoic acid |
| InChIKey | MRYIHKCPPKHOPJ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)