CAS 2086809-58-5 appears in our catalog under these names: SRI–29329, SRI-29329, 98%, SRI-29329/ 99.49% (existing batch purity), N2-((1S,2S)-2-Aminocyclohexyl)-N6-(3-chlorophenyl)-9-isopropyl-9H-purine-2,6-diamine, SRI-29329 98%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 50 mg.
2-N-[(1S,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine (CAS 2086809-58-5) is a chemical compound with the molecular formula C20H26ClN7 and a molecular weight of 399.9 g/mol. IUPAC name: 2-N-[(1S,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine. InChIKey: JPJBCKSRGYPABG-HOTGVXAUSA-N.
| Molecular formula | C20H26ClN7 |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | 2-N-[(1S,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine |
| InChIKey | JPJBCKSRGYPABG-HOTGVXAUSA-N |
| SMILES | CC(C)N1C=NC2=C(N=C(N=C21)N[C@H]3CCCC[C@@H]3N)NC4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)