Products 2088001-23-2

CAS 2088001-23-2 is the registry number for TG2 inhibitor VA4, 99.66%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide (CAS 2088001-23-2) is a chemical compound with the molecular formula C17H13ClFNO3 and a molecular weight of 333.7 g/mol. IUPAC name: N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide. InChIKey: LCMOHFZGRVNOPO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13ClFNO3
Molecular weight333.7 g/mol
IUPAC nameN-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide
InChIKeyLCMOHFZGRVNOPO-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Cl)NC(=O)C(=O)CC(=O)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)