CAS 2088001-23-2 is the registry number for TG2 inhibitor VA4, 99.66%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 5 mg, 25 mg.
N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide (CAS 2088001-23-2) is a chemical compound with the molecular formula C17H13ClFNO3 and a molecular weight of 333.7 g/mol. IUPAC name: N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide. InChIKey: LCMOHFZGRVNOPO-UHFFFAOYSA-N.
| Molecular formula | C17H13ClFNO3 |
|---|---|
| Molecular weight | 333.7 g/mol |
| IUPAC name | N-(5-chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide |
| InChIKey | LCMOHFZGRVNOPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)NC(=O)C(=O)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)