Products 2088021-81-0
CAS 2088021-81-0 is the registry number for Kyoto probe 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[6-amino-9-(4-fluorophenyl)xanthen-3-ylidene]azanium;2,2,2-trifluoroacetate (CAS 2088021-81-0) is a chemical compound with the molecular formula C21H14F4N2O3 and a molecular weight of 418.3 g/mol. IUPAC name: [6-amino-9-(4-fluorophenyl)xanthen-3-ylidene]azanium;2,2,2-trifluoroacetate. InChIKey: ADFLZJALCLDWDM-UHFFFAOYSA-N.
| Molecular formula | C21H14F4N2O3 |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | [6-amino-9-(4-fluorophenyl)xanthen-3-ylidene]azanium;2,2,2-trifluoroacetate |
| InChIKey | ADFLZJALCLDWDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C=CC(=[NH2+])C=C3OC4=C2C=CC(=C4)N)F.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Kyoto probe 1, orb3133125