CAS 2088056-49-7 is the registry number for 3-Fluoro-5-((2R,4S)-4-fluoropyrrolidin-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-5-[(2R,4S)-4-fluoropyrrolidin-2-yl]pyridine (CAS 2088056-49-7) is a chemical compound with the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. IUPAC name: 3-fluoro-5-[(2R,4S)-4-fluoropyrrolidin-2-yl]pyridine. InChIKey: KCKAIFFKJSPMKW-DTWKUNHWSA-N.
| Molecular formula | C9H10F2N2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3-fluoro-5-[(2R,4S)-4-fluoropyrrolidin-2-yl]pyridine |
| InChIKey | KCKAIFFKJSPMKW-DTWKUNHWSA-N |
| SMILES | C1[C@@H](CN[C@H]1C2=CC(=CN=C2)F)F |
Computed by PubChem (NCBI)