CAS 2088272-67-5 appears in our catalog under these names: EST64454 Maleic acid salt/ 98.71% (existing batch purity), EST64454 Maleic acid salt, EST64454 (maleate). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg.
(Z)-but-2-enedioic acid;1-[4-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone (CAS 2088272-67-5) is a chemical compound with the molecular formula C22H26F2N4O6 and a molecular weight of 480.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;1-[4-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone. InChIKey: PCTMFBABXPJDHV-BTJKTKAUSA-N.
| Molecular formula | C22H26F2N4O6 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;1-[4-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]piperazin-1-yl]ethanone |
| InChIKey | PCTMFBABXPJDHV-BTJKTKAUSA-N |
| SMILES | CC(=O)N1CCN(CC1)CCOCC2=NN(C=C2)C3=CC(=C(C=C3)F)F.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)