CAS 2088367-87-5 is the registry number for 5-Carbamoyl-2-(trifluoromethoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[5-carbamoyl-2-(trifluoromethoxy)phenyl]boronic acid (CAS 2088367-87-5) is a chemical compound with the molecular formula C8H7BF3NO4 and a molecular weight of 248.95 g/mol. IUPAC name: [5-carbamoyl-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: PIVJPVFPITTYSD-UHFFFAOYSA-N.
| Molecular formula | C8H7BF3NO4 |
|---|---|
| Molecular weight | 248.95 g/mol |
| IUPAC name | [5-carbamoyl-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | PIVJPVFPITTYSD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)