CAS 208850-35-5 appears in our catalog under these names: DAF-2T, DAF-2T Solution. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, Get quote.
3',6'-dihydroxyspiro[2H-furo[3,4-f]benzotriazole-7,9'-xanthene]-5-one (CAS 208850-35-5) is a chemical compound with the molecular formula C20H11N3O5 and a molecular weight of 373.3 g/mol. IUPAC name: 3',6'-dihydroxyspiro[2H-furo[3,4-f]benzotriazole-7,9'-xanthene]-5-one. InChIKey: AGQDGLGMJJDMKK-UHFFFAOYSA-N.
| Molecular formula | C20H11N3O5 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 3',6'-dihydroxyspiro[2H-furo[3,4-f]benzotriazole-7,9'-xanthene]-5-one |
| InChIKey | AGQDGLGMJJDMKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=C(C24C5=CC6=NNN=C6C=C5C(=O)O4)C=CC(=C3)O |
Computed by PubChem (NCBI)