Products 2088856-21-5

CAS 2088856-21-5 appears in our catalog under these names: 9–Mesityl–10–phenylacridin–10–ium chloride, 9-Mesityl-10-phenylacridin-10-ium chloride, 9-MESITYL-10-PHENYLACRIDIN-10-IUM CHLORIDE, 97%+(HPLC),RG. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.

Structural formula: {0} (CAS {1})

10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium chloride (CAS 2088856-21-5) is a chemical compound with the molecular formula C28H24ClN and a molecular weight of 409.9 g/mol. IUPAC name: 10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium chloride. InChIKey: CEPCNMTVPWXTMM-UHFFFAOYSA-M.

Identity
Molecular formulaC28H24ClN
Molecular weight409.9 g/mol
IUPAC name10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium chloride
InChIKeyCEPCNMTVPWXTMM-UHFFFAOYSA-M
SMILESCC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C5=CC=CC=C5)C.[Cl-]

Computed by PubChem (NCBI)